Structure of PDB 4i0t Chain A Binding Site BS01 |
|
|
Ligand ID | 1B6 |
InChI | InChI=1S/C18H22N6O/c1-18(2,3)23-17(25)11-8-19-16-14(11)22-12(9-20-16)15-13-6-4-5-7-24(13)10-21-15/h8-10H,4-7H2,1-3H3,(H,19,20)(H,23,25) |
InChIKey | NEVNJCLJFXHCCC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC(C)(C)NC(=O)c1c[nH]c2ncc(nc12)c3ncn4CCCCc34 | ACDLabs 12.01 | O=C(NC(C)(C)C)c2cnc1ncc(nc12)c3ncn4c3CCCC4 | OpenEye OEToolkits 1.7.6 | CC(C)(C)NC(=O)c1c[nH]c2c1nc(cn2)c3c4n(cn3)CCCC4 |
|
Formula | C18 H22 N6 O |
Name | N-tert-butyl-2-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-1-yl)-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
ChEMBL | CHEMBL2347996 |
DrugBank | |
ZINC | ZINC000095605032
|
PDB chain | 4i0t Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|