Structure of PDB 4hvi Chain A Binding Site BS01 |
|
|
Ligand ID | 19S |
InChI | InChI=1S/C18H23N5O2/c1-11(18(25)23-7-3-2-4-8-23)21-17(24)13-9-19-16-15(13)22-14(10-20-16)12-5-6-12/h9-12H,2-8H2,1H3,(H,19,20)(H,21,24)/t11-/m1/s1 |
InChIKey | STEKXUJMQOKLQV-LLVKDONJSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | C[C@@H](NC(=O)c1c[nH]c2ncc(nc12)C3CC3)C(=O)N4CCCCC4 | ACDLabs 12.01 | O=C(N1CCCCC1)C(NC(=O)c3c2nc(cnc2nc3)C4CC4)C | OpenEye OEToolkits 1.7.6 | C[C@H](C(=O)N1CCCCC1)NC(=O)c2c[nH]c3c2nc(cn3)C4CC4 | OpenEye OEToolkits 1.7.6 | CC(C(=O)N1CCCCC1)NC(=O)c2c[nH]c3c2nc(cn3)C4CC4 | CACTVS 3.370 | C[CH](NC(=O)c1c[nH]c2ncc(nc12)C3CC3)C(=O)N4CCCCC4 |
|
Formula | C18 H23 N5 O2 |
Name | 2-cyclopropyl-N-[(2R)-1-oxo-1-(piperidin-1-yl)propan-2-yl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
ChEMBL | CHEMBL2325909 |
DrugBank | |
ZINC | ZINC000095585633
|
PDB chain | 4hvi Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|