Structure of PDB 4hvh Chain A Binding Site BS01 |
|
|
Ligand ID | 19R |
InChI | InChI=1S/C15H20N4O2/c1-8(15(2,3)21)18-14(20)10-6-16-13-12(10)19-11(7-17-13)9-4-5-9/h6-9,21H,4-5H2,1-3H3,(H,16,17)(H,18,20)/t8-/m1/s1 |
InChIKey | ODYYFDDUIDLRBK-MRVPVSSYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | C[CH](NC(=O)c1c[nH]c2ncc(nc12)C3CC3)C(C)(C)O | OpenEye OEToolkits 1.7.6 | C[C@H](C(C)(C)O)NC(=O)c1c[nH]c2c1nc(cn2)C3CC3 | OpenEye OEToolkits 1.7.6 | CC(C(C)(C)O)NC(=O)c1c[nH]c2c1nc(cn2)C3CC3 | CACTVS 3.370 | C[C@@H](NC(=O)c1c[nH]c2ncc(nc12)C3CC3)C(C)(C)O | ACDLabs 12.01 | O=C(c2c1nc(cnc1nc2)C3CC3)NC(C)C(O)(C)C |
|
Formula | C15 H20 N4 O2 |
Name | 2-cyclopropyl-N-[(2R)-3-hydroxy-3-methylbutan-2-yl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
ChEMBL | CHEMBL2325905 |
DrugBank | |
ZINC | ZINC000095585780
|
PDB chain | 4hvh Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|