Structure of PDB 4hni Chain A Binding Site BS01 |
|
|
Ligand ID | 16W |
InChI | InChI=1S/C17H18ClN5O2/c18-11-2-1-3-13(8-11)25-9-14-15-16(19)20-10-21-17(15)23(22-14)12-4-6-24-7-5-12/h1-3,8,10,12H,4-7,9H2,(H2,19,20,21) |
InChIKey | AUMDBEHGJRZSOO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Nc1ncnc2n(nc(COc3cccc(Cl)c3)c12)C4CCOCC4 | ACDLabs 12.01 | Clc4cccc(OCc1nn(c2ncnc(N)c12)C3CCOCC3)c4 | OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)Cl)OCc2c3c(ncnc3n(n2)C4CCOCC4)N |
|
Formula | C17 H18 Cl N5 O2 |
Name | 3-[(3-chlorophenoxy)methyl]-1-(tetrahydro-2H-pyran-4-yl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
ChEMBL | CHEMBL2069623 |
DrugBank | |
ZINC | ZINC000043207291
|
PDB chain | 4hni Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D128 K130 |
Catalytic site (residue number reindexed from 1) |
D119 K121 |
Enzyme Commision number |
2.7.11.1: non-specific serine/threonine protein kinase. |
|
|
|