Structure of PDB 4hjs Chain A Binding Site BS01 |
|
|
Ligand ID | 18J |
InChI | InChI=1S/C18H21NO3S/c1-4-23(21,22)19-17-9-7-15(8-10-17)5-6-16-11-13(2)18(20)14(3)12-16/h5-12,19-20H,4H2,1-3H3/b6-5+ |
InChIKey | ORNLONLBPQOYPF-AATRIKPKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CCS(=O)(=O)Nc1ccc(cc1)C=Cc2cc(c(c(c2)C)O)C | OpenEye OEToolkits 1.7.6 | CCS(=O)(=O)Nc1ccc(cc1)/C=C/c2cc(c(c(c2)C)O)C | CACTVS 3.370 | CC[S](=O)(=O)Nc1ccc(cc1)/C=C/c2cc(C)c(O)c(C)c2 | ACDLabs 12.01 | O=S(=O)(Nc1ccc(cc1)\C=C\c2cc(c(O)c(c2)C)C)CC | CACTVS 3.370 | CC[S](=O)(=O)Nc1ccc(cc1)C=Cc2cc(C)c(O)c(C)c2 |
|
Formula | C18 H21 N O3 S |
Name | N-{4-[(E)-2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]phenyl}ethanesulfonamide; (E)-N-(4-(4-HYDROXY-3,5-DIMETHYLSTYRYL)ETHANESULFONAMIDE, bound form |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921262
|
PDB chain | 4hjs Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|