Structure of PDB 4hgl Chain A Binding Site BS01 |
|
|
Ligand ID | 0YO |
InChI | InChI=1S/C21H17N5O2/c1-28-18-11-24-20(13-8-12-4-2-3-5-15(12)23-10-13)26-19(18)17-9-14-16(25-17)6-7-22-21(14)27/h2-5,8-11,25H,6-7H2,1H3,(H,22,27) |
InChIKey | CIUATZJWGJGLPW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | COc1cnc(nc1c2cc3c([nH]2)CCNC3=O)c4cc5ccccc5nc4 | ACDLabs 12.01 | O=C2c1cc(nc1CCN2)c3nc(ncc3OC)c4cc5ccccc5nc4 | CACTVS 3.370 | COc1cnc(nc1c2[nH]c3CCNC(=O)c3c2)c4cnc5ccccc5c4 |
|
Formula | C21 H17 N5 O2 |
Name | 2-[5-methoxy-2-(quinolin-3-yl)pyrimidin-4-yl]-1,5,6,7-tetrahydro-4H-pyrrolo[3,2-c]pyridin-4-one |
ChEMBL | CHEMBL2203552 |
DrugBank | |
ZINC | ZINC000095559065
|
PDB chain | 4hgl Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D162 K164 T212 |
Catalytic site (residue number reindexed from 1) |
D130 K132 T180 |
Enzyme Commision number |
2.7.11.1: non-specific serine/threonine protein kinase. |
|
|
|