Structure of PDB 4hgd Chain A Binding Site BS01 |
|
|
Ligand ID | KGT |
InChI | InChI=1S/C10H14N2O7S/c13-6(10(18)19)1-2-7(14)12-5(4-20)9(17)11-3-8(15)16/h5,20H,1-4H2,(H,11,17)(H,12,14)(H,15,16)(H,18,19)/t5-/m0/s1 |
InChIKey | PMIVQUCENWNWHX-YFKPBYRVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | OC(=O)CNC(=O)[CH](CS)NC(=O)CCC(=O)C(O)=O | OpenEye OEToolkits 1.7.6 | C(CC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)C(=O)O | CACTVS 3.370 | OC(=O)CNC(=O)[C@H](CS)NC(=O)CCC(=O)C(O)=O | ACDLabs 12.01 | O=C(NCC(=O)O)C(NC(=O)CCC(=O)C(=O)O)CS | OpenEye OEToolkits 1.7.6 | C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(=O)C(=O)O |
|
Formula | C10 H14 N2 O7 S |
Name | N-(4-carboxy-4-oxobutanoyl)-L-cysteinylglycine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098209073
|
PDB chain | 4hgd Chain A Residue 407
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
K127 S169 |
Catalytic site (residue number reindexed from 1) |
K123 S164 |
Enzyme Commision number |
3.5.1.128: deaminated glutathione amidase. |
|
|
|