Structure of PDB 4hby Chain A Binding Site BS01 |
|
|
Ligand ID | 13F |
InChI | InChI=1S/C15H15N3O3S/c1-18-10-11-9-13(7-8-14(11)16-15(18)19)22(20,21)17-12-5-3-2-4-6-12/h2-9,17H,10H2,1H3,(H,16,19) |
InChIKey | MUQCGKPYCUDNMX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CN1Cc2cc(ccc2NC1=O)[S](=O)(=O)Nc3ccccc3 | OpenEye OEToolkits 1.7.6 | CN1Cc2cc(ccc2NC1=O)S(=O)(=O)Nc3ccccc3 | ACDLabs 12.01 | O=S(=O)(c1ccc2NC(=O)N(Cc2c1)C)Nc3ccccc3 |
|
Formula | C15 H15 N3 O3 S |
Name | 3-methyl-2-oxo-N-phenyl-1,2,3,4-tetrahydroquinazoline-6-sulfonamide |
ChEMBL | CHEMBL2179384 |
DrugBank | |
ZINC | ZINC000095574451
|
PDB chain | 4hby Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|