Structure of PDB 4h58 Chain A Binding Site BS01 |
|
|
Ligand ID | 10Z |
InChI | InChI=1S/C23H23N5O/c1-29-13-12-25-15-17-2-5-21(6-3-17)27-23-26-16-20-14-19(4-7-22(20)28-23)18-8-10-24-11-9-18/h2-11,14,16,25H,12-13,15H2,1H3,(H,26,27,28) |
InChIKey | UKKAXPVDQSQDFB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | COCCNCc1ccc(Nc2ncc3cc(ccc3n2)c4ccncc4)cc1 | ACDLabs 12.01 | n3c1c(cc(cc1)c2ccncc2)cnc3Nc4ccc(cc4)CNCCOC | OpenEye OEToolkits 1.7.6 | COCCNCc1ccc(cc1)Nc2ncc3cc(ccc3n2)c4ccncc4 |
|
Formula | C23 H23 N5 O |
Name | N-(4-{[(2-methoxyethyl)amino]methyl}phenyl)-6-(pyridin-4-yl)quinazolin-2-amine |
ChEMBL | CHEMBL2335881 |
DrugBank | |
ZINC | ZINC000095590529
|
PDB chain | 4h58 Chain A Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|