Structure of PDB 4h38 Chain A Binding Site BS01 |
|
|
Ligand ID | 0YX |
InChI | InChI=1S/C21H28BrO5P/c1-2-3-4-5-6-7-13-26-19-10-8-9-17(14-19)16-27-20-12-11-18(22)15-21(20)28(23,24)25/h8-12,14-15H,2-7,13,16H2,1H3,(H2,23,24,25) |
InChIKey | XTZIHTNEICPHNT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CCCCCCCCOc1cccc(c1)COc2ccc(cc2P(=O)(O)O)Br | ACDLabs 12.01 | Brc2cc(c(OCc1cccc(OCCCCCCCC)c1)cc2)P(=O)(O)O | CACTVS 3.370 | CCCCCCCCOc1cccc(COc2ccc(Br)cc2[P](O)(O)=O)c1 |
|
Formula | C21 H28 Br O5 P |
Name | (5-bromo-2-{[3-(octyloxy)benzyl]oxy}phenyl)phosphonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098207900
|
PDB chain | 4h38 Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D26 H43 L137 |
Catalytic site (residue number reindexed from 1) |
D12 H29 L111 |
Enzyme Commision number |
2.5.1.31: ditrans,polycis-undecaprenyl-diphosphate synthase [(2E,6E)-farnesyl- diphosphate specific]. |
|
|
|