Structure of PDB 4gj3 Chain A Binding Site BS01 |
|
|
Ligand ID | 0XP |
InChI | InChI=1S/C17H11Cl2FN4O2/c18-11-3-8(7-21)4-12(19)15(11)17(26)23-9-1-2-22-14(5-9)24-16(25)10-6-13(10)20/h1-5,10,13H,6H2,(H2,22,23,24,25,26)/t10-,13+/m0/s1 |
InChIKey | TZBYGJGLZFYXII-GXFFZTMASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cnc(cc1NC(=O)c2c(cc(cc2Cl)C#N)Cl)NC(=O)C3CC3F | CACTVS 3.370 | F[C@@H]1C[C@@H]1C(=O)Nc2cc(NC(=O)c3c(Cl)cc(cc3Cl)C#N)ccn2 | CACTVS 3.370 | F[CH]1C[CH]1C(=O)Nc2cc(NC(=O)c3c(Cl)cc(cc3Cl)C#N)ccn2 | ACDLabs 12.01 | O=C(Nc1nccc(c1)NC(=O)c2c(Cl)cc(C#N)cc2Cl)C3CC3F | OpenEye OEToolkits 1.7.6 | c1cnc(cc1NC(=O)c2c(cc(cc2Cl)C#N)Cl)NC(=O)[C@H]3C[C@H]3F |
|
Formula | C17 H11 Cl2 F N4 O2 |
Name | 2,6-dichloro-4-cyano-N-[2-({[(1R,2R)-2-fluorocyclopropyl]carbonyl}amino)pyridin-4-yl]benzamide |
ChEMBL | CHEMBL2387221 |
DrugBank | |
ZINC | ZINC000095920927
|
PDB chain | 4gj3 Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|