Structure of PDB 4gfg Chain A Binding Site BS01 |
|
|
Ligand ID | 0XF |
InChI | InChI=1S/C18H25N7O/c1-10-7-8-15(21-11(10)2)23-14-9-16(24-25-17(14)18(20)26)22-13-6-4-3-5-12(13)19/h7-9,12-13H,3-6,19H2,1-2H3,(H2,20,26)(H2,21,22,23,24)/t12-,13+/m0/s1 |
InChIKey | XJZVCDVZCRLIKN-QWHCGFSZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | Cc1ccc(nc1C)Nc2cc(nnc2C(=O)N)NC3CCCCC3N | CACTVS 3.370 | Cc1ccc(Nc2cc(N[C@@H]3CCCC[C@@H]3N)nnc2C(N)=O)nc1C | OpenEye OEToolkits 1.7.6 | Cc1ccc(nc1C)Nc2cc(nnc2C(=O)N)N[C@@H]3CCCC[C@@H]3N | CACTVS 3.370 | Cc1ccc(Nc2cc(N[CH]3CCCC[CH]3N)nnc2C(N)=O)nc1C | ACDLabs 12.01 | O=C(c2nnc(cc2Nc1nc(c(cc1)C)C)NC3CCCCC3N)N |
|
Formula | C18 H25 N7 O |
Name | 6-{[(1R,2S)-2-aminocyclohexyl]amino}-4-[(5,6-dimethylpyridin-2-yl)amino]pyridazine-3-carboxamide |
ChEMBL | CHEMBL3237561 |
DrugBank | |
ZINC | ZINC000095921150
|
PDB chain | 4gfg Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|