Structure of PDB 4gee Chain A Binding Site BS01 |
|
|
Ligand ID | 0WT |
InChI | InChI=1S/C17H18ClN7O/c1-2-11-13(18)12-15(22-11)23-17(26-8-3-20-7-21-4-8)24-16(12)25-5-9-10(6-25)14(9)19/h3-4,7,9-10,14H,2,5-6,19H2,1H3,(H,22,23,24)/t9-,10+,14+ |
InChIKey | YZRGALHCPBRTES-MSRIBSCDSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCc1[nH]c2nc(Oc3cncnc3)nc(N4C[CH]5[CH](N)[CH]5C4)c2c1Cl | OpenEye OEToolkits 1.7.6 | CCc1c(c2c([nH]1)nc(nc2N3C[C@@H]4[C@H](C3)C4N)Oc5cncnc5)Cl | ACDLabs 12.01 | Clc3c2c(nc(Oc1cncnc1)nc2nc3CC)N5CC4C(N)C4C5 | CACTVS 3.370 | CCc1[nH]c2nc(Oc3cncnc3)nc(N4C[C@H]5[C@H](N)[C@H]5C4)c2c1Cl | OpenEye OEToolkits 1.7.6 | CCc1c(c2c([nH]1)nc(nc2N3CC4C(C3)C4N)Oc5cncnc5)Cl |
|
Formula | C17 H18 Cl N7 O |
Name | (1R,5S,6s)-3-[5-chloro-6-ethyl-2-(pyrimidin-5-yloxy)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-3-azabicyclo[3.1.0]hexan-6-amine |
ChEMBL | CHEMBL2338001 |
DrugBank | |
ZINC | ZINC000103096070
|
PDB chain | 4gee Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
5.6.2.2: DNA topoisomerase (ATP-hydrolyzing). |
|
|
|