Structure of PDB 4gdb Chain A Binding Site BS01 |
|
|
Ligand ID | 17O |
InChI | InChI=1S/C12H11N3O3S2/c16-3-7-2-13-10(12(17)18)5-20-11(7)9-1-8-4-19-6-15(8)14-9/h1-3,5,11,13H,4,6H2,(H,17,18)/t11-/m1/s1 |
InChIKey | BBUNPRSRYKGFTQ-LLVKDONJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1c2n(nc1C3C(=CNC(=CS3)C(=O)O)C=O)CSC2 | CACTVS 3.370 | OC(=O)C1=CS[CH](C(=CN1)C=O)c2cc3CSCn3n2 | ACDLabs 12.01 | O=C(O)C3=CSC(c1nn2c(c1)CSC2)C(=CN3)C=O | CACTVS 3.370 | OC(=O)C1=CS[C@H](C(=CN1)C=O)c2cc3CSCn3n2 |
|
Formula | C12 H11 N3 O3 S2 |
Name | (7R)-6-formyl-7-(4H-pyrazolo[1,5-c][1,3]thiazol-2-yl)-4,7-dihydro-1,4-thiazepine-3-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000103521504
|
PDB chain | 4gdb Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|