Structure of PDB 4ga3 Chain A Binding Site BS01 |
|
|
Ligand ID | 4GA |
InChI | InChI=1S/C9H18N2O7P2/c1-2-3-4-10-5-6-11(8-10)7-9(12,19(13,14)15)20(16,17)18/h5-6,8,12H,2-4,7H2,1H3,(H3-,13,14,15,16,17,18)/p+1 |
InChIKey | JCMWHMYRNYPQAZ-UHFFFAOYSA-O |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=P(O)(O)C(O)(P(=O)(O)O)C[n+]1ccn(c1)CCCC | CACTVS 3.370 | CCCCn1cc[n+](CC(O)([P](O)(O)=O)[P](O)(O)=O)c1 | OpenEye OEToolkits 1.7.6 | CCCCn1cc[n+](c1)CC(O)(P(=O)(O)O)P(=O)(O)O |
|
Formula | C9 H19 N2 O7 P2 |
Name | 1-butyl-3-(2-hydroxy-2,2-diphosphonoethyl)-1H-imidazol-3-ium |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095589259
|
PDB chain | 4ga3 Chain A Residue 1001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|