Structure of PDB 4g5p Chain A Binding Site BS01 |
|
|
Ligand ID | 0WN |
InChI | InChI=1S/C24H27ClFN5O3/c1-31(2)8-3-4-23(32)30-21-11-17-20(12-22(21)34-16-7-9-33-13-16)27-14-28-24(17)29-15-5-6-19(26)18(25)10-15/h5-6,10-12,14,16H,3-4,7-9,13H2,1-2H3,(H,30,32)(H,27,28,29)/t16-/m0/s1 |
InChIKey | JSENTLOBWVHLNR-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CN(C)CCCC(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1O[CH]4CCOC4 | OpenEye OEToolkits 1.7.6 | CN(C)CCCC(=O)Nc1cc2c(cc1OC3CCOC3)ncnc2Nc4ccc(c(c4)Cl)F | ACDLabs 12.01 | Fc1ccc(cc1Cl)Nc4ncnc3cc(OC2CCOC2)c(cc34)NC(=O)CCCN(C)C | CACTVS 3.370 | CN(C)CCCC(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1O[C@H]4CCOC4 | OpenEye OEToolkits 1.7.6 | CN(C)CCCC(=O)Nc1cc2c(cc1O[C@H]3CCOC3)ncnc2Nc4ccc(c(c4)Cl)F |
|
Formula | C24 H27 Cl F N5 O3 |
Name | N-{4-[(3-chloro-4-fluorophenyl)amino]-7-[(3S)-tetrahydrofuran-3-yloxy]quinazolin-6-yl}-4-(dimethylamino)butanamide; Afatinib, bound form |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098207882
|
PDB chain | 4g5p Chain A Residue 1101
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|