Structure of PDB 4g31 Chain A Binding Site BS01 |
|
|
Ligand ID | 0WH |
InChI | InChI=1S/C24H20F3N5O/c1-31-12-18(21-22(28)29-13-30-23(21)31)15-5-6-19-16(11-15)7-8-32(19)20(33)10-14-3-2-4-17(9-14)24(25,26)27/h2-6,9,11-13H,7-8,10H2,1H3,(H2,28,29,30) |
InChIKey | SIXVRXARNAVBTC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Cn1cc(c2ccc3N(CCc3c2)C(=O)Cc4cccc(c4)C(F)(F)F)c5c(N)ncnc15 | OpenEye OEToolkits 1.7.6 | Cn1cc(c2c1ncnc2N)c3ccc4c(c3)CCN4C(=O)Cc5cccc(c5)C(F)(F)F | ACDLabs 12.01 | FC(F)(F)c1cccc(c1)CC(=O)N3c2ccc(cc2CC3)c5c4c(ncnc4n(c5)C)N |
|
Formula | C24 H20 F3 N5 O |
Name | 1-[5-(4-amino-7-methyl-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-2,3-dihydro-1H-indol-1-yl]-2-[3-(trifluoromethyl)phenyl]ethanone |
ChEMBL | CHEMBL2171124 |
DrugBank | |
ZINC | ZINC000095550949
|
PDB chain | 4g31 Chain A Residue 1102
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|