Structure of PDB 4g2f Chain A Binding Site BS01 |
|
|
Ligand ID | C07 |
InChI | InChI=1S/C18H18N4O2/c1-10-6-7-11(23)8-14(10)22-17-15(16(19)20-9-21-17)12-4-2-3-5-13(12)18(22)24/h6-9,23H,2-5H2,1H3,(H2,19,20,21) |
InChIKey | ZQQZSFIPDUAFMC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C2C4=C(c1c(ncnc1N2c3cc(O)ccc3C)N)CCCC4 | OpenEye OEToolkits 1.7.6 | Cc1ccc(cc1N2c3c(c(ncn3)N)C4=C(C2=O)CCCC4)O | CACTVS 3.370 | Cc1ccc(O)cc1N2C(=O)C3=C(CCCC3)c4c(N)ncnc24 |
|
Formula | C18 H18 N4 O2 |
Name | 1-amino-5-(5-hydroxy-2-methylphenyl)-7,8,9,10-tetrahydropyrimido[4,5-c]isoquinolin-6(5H)-one |
ChEMBL | CHEMBL2152704 |
DrugBank | |
ZINC | ZINC000095572373
|
PDB chain | 4g2f Chain A Residue 1001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|