Structure of PDB 4fz7 Chain A Binding Site BS01 |
|
|
Ligand ID | 0VH |
InChI | InChI=1S/C18H25N7O/c1-2-11-6-5-9-15(21-11)23-14-10-16(24-25-17(14)18(20)26)22-13-8-4-3-7-12(13)19/h5-6,9-10,12-13H,2-4,7-8,19H2,1H3,(H2,20,26)(H2,21,22,23,24)/t12-,13+/m0/s1 |
InChIKey | WDVJRXQKCPLXTN-QWHCGFSZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCc1cccc(Nc2cc(N[C@@H]3CCCC[C@@H]3N)nnc2C(N)=O)n1 | OpenEye OEToolkits 1.7.6 | CCc1cccc(n1)Nc2cc(nnc2C(=O)N)NC3CCCCC3N | OpenEye OEToolkits 1.7.6 | CCc1cccc(n1)Nc2cc(nnc2C(=O)N)N[C@@H]3CCCC[C@@H]3N | CACTVS 3.370 | CCc1cccc(Nc2cc(N[CH]3CCCC[CH]3N)nnc2C(N)=O)n1 | ACDLabs 12.01 | O=C(c2nnc(cc2Nc1nc(ccc1)CC)NC3CCCCC3N)N |
|
Formula | C18 H25 N7 O |
Name | 6-{[(1R,2S)-2-aminocyclohexyl]amino}-4-[(6-ethylpyridin-2-yl)amino]pyridazine-3-carboxamide |
ChEMBL | CHEMBL3237556 |
DrugBank | |
ZINC | ZINC000095921204
|
PDB chain | 4fz7 Chain A Residue 701
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|