Structure of PDB 4fxq Chain A Binding Site BS01 |
|
|
Ligand ID | G9L |
InChI | InChI=1S/C20H24FN3O2/c21-14-4-5-15-16(12-14)20(26)22-18-6-11-24(13-17(15)18)19(25)7-10-23-8-2-1-3-9-23/h4-5,12H,1-3,6-11,13H2,(H,22,26) |
InChIKey | CTOQXIXQHAILCA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | Fc1ccc2C3=C(CCN(C3)C(=O)CCN4CCCCC4)NC(=O)c2c1 | OpenEye OEToolkits 1.7.0 | c1cc2c(cc1F)C(=O)NC3=C2CN(CC3)C(=O)CCN4CCCCC4 |
|
Formula | C20 H24 F N3 O2 |
Name | 8-fluoro-2-(3-piperidin-1-ylpropanoyl)-1,3,4,5-tetrahydrobenzo[c][1,6]naphthyridin-6(2H)-one |
ChEMBL | CHEMBL84096 |
DrugBank | |
ZINC | ZINC000013536336
|
PDB chain | 4fxq Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
S387 E431 |
Catalytic site (residue number reindexed from 1) |
S369 E413 |
Enzyme Commision number |
2.4.2.- |
|
|
|