Structure of PDB 4fue Chain A Binding Site BS01 |
|
|
Ligand ID | 7UP |
InChI | InChI=1S/C22H19N3/c23-22(24)20-8-7-17-11-15(3-5-18(17)13-20)1-2-16-4-6-21-14-25-10-9-19(21)12-16/h3-8,11-13,25H,9-10,14H2,(H3,23,24) |
InChIKey | ACKRFKIRNILEQJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc2cc(ccc2cc1C#Cc3ccc4c(c3)CCNC4)C(=N)N | OpenEye OEToolkits 1.7.6 | [H]/N=C(/c1ccc2cc(ccc2c1)C#Cc3ccc4c(c3)CCNC4)\N | CACTVS 3.370 | NC(=N)c1ccc2cc(ccc2c1)C#Cc3ccc4CNCCc4c3 | ACDLabs 12.01 | [N@H]=C(N)c4ccc3cc(C#Cc1ccc2c(c1)CCNC2)ccc3c4 |
|
Formula | C22 H19 N3 |
Name | 6-(1,2,3,4-tetrahydroisoquinolin-6-ylethynyl)naphthalene-2-carboximidamide |
ChEMBL | CHEMBL561413 |
DrugBank | |
ZINC | ZINC000033504117
|
PDB chain | 4fue Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|