Structure of PDB 4ftu Chain A Binding Site BS01 |
|
|
Ligand ID | 7HK |
InChI | InChI=1S/C21H18N4O3/c1-28-20(26)11-13-2-5-17-19(10-13)25-21(27)16-4-3-15(12-18(16)24-17)23-14-6-8-22-9-7-14/h2-10,12,24H,11H2,1H3,(H,22,23)(H,25,27) |
InChIKey | UHXSMHRHMWNZNO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | COC(=O)Cc1ccc2c(c1)NC(=O)c3ccc(cc3N2)Nc4ccncc4 | CACTVS 3.370 | COC(=O)Cc1ccc2Nc3cc(Nc4ccncc4)ccc3C(=O)Nc2c1 | ACDLabs 12.01 | O=C(OC)Cc4cc1c(Nc3c(C(=O)N1)ccc(Nc2ccncc2)c3)cc4 |
|
Formula | C21 H18 N4 O3 |
Name | methyl [11-oxo-3-(pyridin-4-ylamino)-10,11-dihydro-5H-dibenzo[b,e][1,4]diazepin-8-yl]acetate |
ChEMBL | CHEMBL564542 |
DrugBank | |
ZINC | ZINC000043015321
|
PDB chain | 4ftu Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|