Structure of PDB 4ftq Chain A Binding Site BS01 |
|
|
Ligand ID | 4HK |
InChI | InChI=1S/C22H20N4O2/c1-2-13-7-18-15(9-20(13)28-17-5-6-27-12-17)8-19-21(25-26-22(18)19)14-3-4-16(10-23)24-11-14/h3-4,7,9,11,17H,2,5-6,8,12H2,1H3,(H,25,26)/t17-/m0/s1 |
InChIKey | OAWMFMUHXBYJGX-KRWDZBQOSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | N#Cc1ncc(cc1)c2c5c(nn2)c4cc(c(OC3CCOC3)cc4C5)CC | CACTVS 3.370 | CCc1cc2c(Cc3c([nH]nc23)c4ccc(nc4)C#N)cc1O[C@H]5CCOC5 | OpenEye OEToolkits 1.7.6 | CCc1cc-2c(cc1OC3CCOC3)Cc4c2n[nH]c4c5ccc(nc5)C#N | OpenEye OEToolkits 1.7.6 | CCc1cc-2c(cc1O[C@H]3CCOC3)Cc4c2n[nH]c4c5ccc(nc5)C#N | CACTVS 3.370 | CCc1cc2c(Cc3c([nH]nc23)c4ccc(nc4)C#N)cc1O[CH]5CCOC5 |
|
Formula | C22 H20 N4 O2 |
Name | 5-{7-ethyl-6-[(3S)-tetrahydrofuran-3-yloxy]-2,4-dihydroindeno[1,2-c]pyrazol-3-yl}pyridine-2-carbonitrile |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921202
|
PDB chain | 4ftq Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|