Structure of PDB 4ft5 Chain A Binding Site BS01 |
|
|
Ligand ID | H2K |
InChI | InChI=1S/C16H15ClN6O2/c17-10-1-2-14(25-12-3-4-19-8-12)13(5-10)22-16(24)23-15-9-20-11(6-18)7-21-15/h1-2,5,7,9,12,19H,3-4,8H2,(H2,21,22,23,24)/t12-/m1/s1 |
InChIKey | XWBVWQBBHHJLKT-GFCCVEGCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(c(cc1Cl)NC(=O)Nc2cnc(cn2)C#N)O[C@@H]3CCNC3 | CACTVS 3.370 | Clc1ccc(O[CH]2CCNC2)c(NC(=O)Nc3cnc(cn3)C#N)c1 | CACTVS 3.370 | Clc1ccc(O[C@@H]2CCNC2)c(NC(=O)Nc3cnc(cn3)C#N)c1 | OpenEye OEToolkits 1.7.6 | c1cc(c(cc1Cl)NC(=O)Nc2cnc(cn2)C#N)OC3CCNC3 | ACDLabs 12.01 | N#Cc1ncc(nc1)NC(=O)Nc3cc(Cl)ccc3OC2CCNC2 |
|
Formula | C16 H15 Cl N6 O2 |
Name | 1-{5-chloro-2-[(3R)-pyrrolidin-3-yloxy]phenyl}-3-(5-cyanopyrazin-2-yl)urea |
ChEMBL | |
DrugBank | |
ZINC | ZINC000043059096
|
PDB chain | 4ft5 Chain A Residue 300
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|