Structure of PDB 4fk6 Chain A Binding Site BS01 |
|
|
Ligand ID | 0UJ |
InChI | InChI=1S/C17H21N5O2S/c1-25(23,24)20-9-15-21-13-8-19-17-12(4-5-18-17)16(13)22(15)14-7-10-2-3-11(14)6-10/h4-5,8,10-11,14,20H,2-3,6-7,9H2,1H3,(H,18,19)/t10-,11+,14+/m0/s1 |
InChIKey | IQHKHGHDPGFXAV-MISXGVKJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CS(=O)(=O)NCc1nc2cnc3c(c2n1C4CC5CCC4C5)cc[nH]3 | ACDLabs 12.01 | O=S(=O)(NCc3nc2cnc1nccc1c2n3C5CC4CCC5C4)C | CACTVS 3.370 | C[S](=O)(=O)NCc1nc2cnc3[nH]ccc3c2n1[C@@H]4C[C@H]5CC[C@@H]4C5 | CACTVS 3.370 | C[S](=O)(=O)NCc1nc2cnc3[nH]ccc3c2n1[CH]4C[CH]5CC[CH]4C5 | OpenEye OEToolkits 1.7.6 | CS(=O)(=O)NCc1nc2cnc3c(c2n1[C@@H]4C[C@H]5CC[C@@H]4C5)cc[nH]3 |
|
Formula | C17 H21 N5 O2 S |
Name | N-({1-[(1R,2R,4S)-bicyclo[2.2.1]hept-2-yl]-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridin-2-yl}methyl)methanesulfonamide |
ChEMBL | CHEMBL2206059 |
DrugBank | |
ZINC | ZINC000072315830
|
PDB chain | 4fk6 Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|