Structure of PDB 4fk3 Chain A Binding Site BS01 |
|
|
Ligand ID | 325 |
InChI | InChI=1S/C21H16F2N4O3S/c1-2-31(29,30)27-17-6-5-16(22)18(19(17)23)20(28)15-11-26-21-14(15)8-13(10-25-21)12-4-3-7-24-9-12/h3-11,27H,2H2,1H3,(H,25,26) |
InChIKey | ILXJWLWSYAWJKZ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC[S](=O)(=O)Nc1ccc(F)c(c1F)C(=O)c2c[nH]c3ncc(cc23)c4cccnc4 | ACDLabs 12.01 | O=S(=O)(Nc1ccc(F)c(c1F)C(=O)c3c2cc(cnc2nc3)c4cccnc4)CC | OpenEye OEToolkits 1.7.6 | CCS(=O)(=O)Nc1ccc(c(c1F)C(=O)c2c[nH]c3c2cc(cn3)c4cccnc4)F |
|
Formula | C21 H16 F2 N4 O3 S |
Name | N-{2,4-difluoro-3-[(5-pyridin-3-yl-1H-pyrrolo[2,3-b]pyridin-3-yl)carbonyl]phenyl}ethanesulfonamide; PLX3203 |
ChEMBL | |
DrugBank | DB07000 |
ZINC |
|
PDB chain | 4fk3 Chain A Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|