Structure of PDB 4fcr Chain A Binding Site BS01 |
|
|
Ligand ID | 0TM |
InChI | InChI=1S/C19H18ClN5O3S/c1-25(2)15(26)9-29-19-23-17(16-10(7-21)8-22-18(16)24-19)11-5-13(27-3)14(28-4)6-12(11)20/h5-6,8H,9H2,1-4H3,(H,22,23,24) |
InChIKey | JLZNENFSPWZCAG-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | COc1cc(Cl)c(cc1OC)c2nc(SCC(=O)N(C)C)nc3[nH]cc(C#N)c23 | OpenEye OEToolkits 1.7.6 | CN(C)C(=O)CSc1nc(c2c(c[nH]c2n1)C#N)c3cc(c(cc3Cl)OC)OC | ACDLabs 12.01 | Clc3cc(OC)c(OC)cc3c1nc(nc2c1c(C#N)cn2)SCC(=O)N(C)C |
|
Formula | C19 H18 Cl N5 O3 S |
Name | 2-{[4-(2-chloro-4,5-dimethoxyphenyl)-5-cyano-7H-pyrrolo[2,3-d]pyrimidin-2-yl]sulfanyl}-N,N-dimethylacetamide |
ChEMBL | CHEMBL2158562 |
DrugBank | |
ZINC | ZINC000059111662
|
PDB chain | 4fcr Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.6.4.10: non-chaperonin molecular chaperone ATPase. |
|
|
|