Structure of PDB 4f7n Chain A Binding Site BS01 |
|
|
Ligand ID | 0SV |
InChI | InChI=1S/C20H30N4O2/c1-15-8-10-16(11-9-15)24-18(14-17(23-24)20(2,3)4)22-19(26)21-12-6-5-7-13-25/h8-11,14,25H,5-7,12-13H2,1-4H3,(H2,21,22,26) |
InChIKey | KYUWRMMQYZFHGQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(NCCCCCO)Nc2cc(nn2c1ccc(cc1)C)C(C)(C)C | CACTVS 3.370 | Cc1ccc(cc1)n2nc(cc2NC(=O)NCCCCCO)C(C)(C)C | OpenEye OEToolkits 1.7.6 | Cc1ccc(cc1)n2c(cc(n2)C(C)(C)C)NC(=O)NCCCCCO |
|
Formula | C20 H30 N4 O2 |
Name | 1-[3-tert-butyl-1-(4-methylphenyl)-1H-pyrazol-5-yl]-3-(5-hydroxypentyl)urea |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921130
|
PDB chain | 4f7n Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|