Structure of PDB 4f6x Chain A Binding Site BS01 |
|
|
Ligand ID | ZYL |
InChI | InChI=1S/C19H23NO5/c1-2-3-4-5-11-25-15-8-6-7-14(12-15)13-20-10-9-16(21)17(18(20)22)19(23)24/h6-10,12,21H,2-5,11,13H2,1H3,(H,23,24) |
InChIKey | IEFKPWNGVIDYEA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)C1=C(O)C=CN(C1=O)Cc2cc(OCCCCCC)ccc2 | OpenEye OEToolkits 1.7.6 | CCCCCCOc1cccc(c1)CN2C=CC(=C(C2=O)C(=O)O)O | CACTVS 3.370 | CCCCCCOc1cccc(CN2C=CC(=C(C(O)=O)C2=O)O)c1 |
|
Formula | C19 H23 N O5 |
Name | 1-[3-(hexyloxy)benzyl]-4-hydroxy-2-oxo-1,2-dihydropyridine-3-carboxylic acid |
ChEMBL | CHEMBL2063256 |
DrugBank | |
ZINC | ZINC000084669316
|
PDB chain | 4f6x Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.5.1.96: 4,4'-diapophytoene synthase. |
|
|
|