Structure of PDB 4f6v Chain A Binding Site BS01 |
|
|
Ligand ID | ZYM |
InChI | InChI=1S/C19H19NO5/c21-17(19(23)24)13-18(22)20-11-5-7-14-6-4-10-16(12-14)25-15-8-2-1-3-9-15/h1-4,6,8-10,12H,5,7,11,13H2,(H,20,22)(H,23,24) |
InChIKey | SJGQLSMZNBWNEL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1ccc(cc1)Oc2cccc(c2)CCCNC(=O)CC(=O)C(=O)O | ACDLabs 12.01 | O=C(O)C(=O)CC(=O)NCCCc2cc(Oc1ccccc1)ccc2 | CACTVS 3.370 | OC(=O)C(=O)CC(=O)NCCCc1cccc(Oc2ccccc2)c1 |
|
Formula | C19 H19 N O5 |
Name | 2,4-dioxo-4-{[3-(3-phenoxyphenyl)propyl]amino}butanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000084669313
|
PDB chain | 4f6v Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.5.1.96: 4,4'-diapophytoene synthase. |
|
|
|