Structure of PDB 4etw Chain A Binding Site BS01 |
|
|
Ligand ID | ZMK |
InChI | InChI=1S/C19H35N2O10PS/c1-19(2,13-31-32(27,28)29)17(25)18(26)21-10-9-14(22)20-11-12-33-16(24)8-6-4-5-7-15(23)30-3/h17,25H,4-13H2,1-3H3,(H,20,22)(H,21,26)(H2,27,28,29)/t17-/m1/s1 |
InChIKey | HCFLUHFHCAMJNF-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)O)CCCCCC(=O)OC | OpenEye OEToolkits 1.7.6 | CC(C)(COP(=O)(O)O)C(C(=O)NCCC(=O)NCCSC(=O)CCCCCC(=O)OC)O | OpenEye OEToolkits 1.7.6 | CC(C)(COP(=O)(O)O)[C@@H](C(=O)NCCC(=O)NCCSC(=O)CCCCCC(=O)OC)O | CACTVS 3.370 | COC(=O)CCCCCC(=O)SCCNC(=O)CCNC(=O)[CH](O)C(C)(C)CO[P](O)(O)=O | CACTVS 3.370 | COC(=O)CCCCCC(=O)SCCNC(=O)CCNC(=O)[C@@H](O)C(C)(C)CO[P](O)(O)=O |
|
Formula | C19 H35 N2 O10 P S |
Name | methyl 7-{[2-({N-[(2S)-2-hydroxy-3,3-dimethyl-4-(phosphonooxy)butanoyl]-beta-alanyl}amino)ethyl]sulfanyl}-7-oxoheptanoate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098209668
|
PDB chain | 4etw Chain B Residue 600
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.1.85: pimeloyl-[acyl-carrier protein] methyl ester esterase. |
|
|
|