Structure of PDB 4esi Chain A Binding Site BS01 |
|
|
Ligand ID | 0RB |
InChI | InChI=1S/C10H9N9O2/c11-10-16-7-6(9(21)17-10)12-3-5(15-7)8(20)13-1-4-2-14-19-18-4/h2-3H,1H2,(H,13,20)(H,14,18,19)(H3,11,15,16,17,21) |
InChIKey | IOLZYHQWMHJFBL-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1c([nH]nn1)CNC(=O)c2cnc3c(n2)NC(=NC3=O)N | CACTVS 3.370 | NC1=NC(=O)c2ncc(nc2N1)C(=O)NCc3[nH]nnc3 | ACDLabs 12.01 | O=C(NCc1cnnn1)c2nc3c(nc2)C(=O)N=C(N)N3 |
|
Formula | C10 H9 N9 O2 |
Name | 2-amino-4-oxo-N-(1H-1,2,3-triazol-5-ylmethyl)-1,4-dihydropteridine-7-carboxamide |
ChEMBL | CHEMBL2089311 |
DrugBank | |
ZINC | ZINC000084759358
|
PDB chain | 4esi Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
V81 E177 R180 |
Catalytic site (residue number reindexed from 1) |
V77 E173 R176 |
Enzyme Commision number |
3.2.2.22: rRNA N-glycosylase. |
|
|
|