Structure of PDB 4ek9 Chain A Binding Site BS01 |
|
|
Ligand ID | EP4 |
InChI | InChI=1S/C12H18N6O3/c1-17(2)3-6-8(19)9(20)12(21-6)18-5-16-7-10(13)14-4-15-11(7)18/h4-6,8-9,12,19-20H,3H2,1-2H3,(H2,13,14,15)/t6-,8-,9-,12-/m1/s1 |
InChIKey | SLNWRDWGFHZRAQ-WOUKDFQISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CN(C)C[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2cnc3c(N)ncnc23 | ACDLabs 12.01 | n2c1c(ncnc1n(c2)C3OC(C(O)C3O)CN(C)C)N | OpenEye OEToolkits 1.7.6 | CN(C)C[C@@H]1[C@H]([C@H]([C@@H](O1)n2cnc3c2ncnc3N)O)O | OpenEye OEToolkits 1.7.6 | CN(C)CC1C(C(C(O1)n2cnc3c2ncnc3N)O)O | CACTVS 3.370 | CN(C)C[CH]1O[CH]([CH](O)[CH]1O)n2cnc3c(N)ncnc23 |
|
Formula | C12 H18 N6 O3 |
Name | 5'-deoxy-5'-(dimethylamino)adenosine |
ChEMBL | CHEMBL472733 |
DrugBank | |
ZINC | ZINC000040914070
|
PDB chain | 4ek9 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.1.1.360: [histone H3]-lysine(79) N-trimethyltransferase. |
|
|
|