Structure of PDB 4eeo Chain A Binding Site BS01 |
|
|
Ligand ID | BBV |
InChI | InChI=1S/C15H21NO6/c1-9(18)16-12-14(20)13(19)11(7-17)22-15(12)21-8-10-5-3-2-4-6-10/h2-6,11-15,17,19-20H,7-8H2,1H3,(H,16,18)/t11-,12-,13-,14-,15+/m1/s1 |
InChIKey | SKOZFDIGKDPQBO-RYPNDVFKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC(=O)N[CH]1[CH](O)[CH](O)[CH](CO)O[CH]1OCc2ccccc2 | ACDLabs 12.01 | O=C(NC2C(O)C(O)C(OC2OCc1ccccc1)CO)C | OpenEye OEToolkits 1.7.6 | CC(=O)NC1C(C(C(OC1OCc2ccccc2)CO)O)O | OpenEye OEToolkits 1.7.6 | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@@H]1OCc2ccccc2)CO)O)O | CACTVS 3.370 | CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1OCc2ccccc2 |
|
Formula | C15 H21 N O6 |
Name | benzyl 2-acetamido-2-deoxy-alpha-D-glucopyranoside; benzyl 2-(acetylamino)-2-deoxy-alpha-D-glucopyranoside; benzyl 2-acetamido-2-deoxy-alpha-D-glucoside; benzyl 2-acetamido-2-deoxy-D-glucoside; benzyl 2-acetamido-2-deoxy-glucoside |
ChEMBL | CHEMBL217900 |
DrugBank | |
ZINC | ZINC000003956715
|
PDB chain | 4eeo Chain D Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|