Structure of PDB 4ebv Chain A Binding Site BS01 |
|
|
Ligand ID | 0O7 |
InChI | InChI=1S/C18H17N3O2S/c1-3-12-4-6-13(7-5-12)14-8-9-16-15(10-14)18-17(11-19-20-18)24(22,23)21(16)2/h4-11H,3H2,1-2H3,(H,19,20) |
InChIKey | ISXAVIPPPMJTPN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=S2(=O)c1cnnc1c4c(N2C)ccc(c3ccc(cc3)CC)c4 | CACTVS 3.370 | CCc1ccc(cc1)c2ccc3N(C)[S](=O)(=O)c4c[nH]nc4c3c2 | OpenEye OEToolkits 1.7.6 | CCc1ccc(cc1)c2ccc3c(c2)-c4c(c[nH]n4)S(=O)(=O)N3C |
|
Formula | C18 H17 N3 O2 S |
Name | 8-(4-ethylphenyl)-5-methyl-2,5-dihydropyrazolo[4,3-c][2,1]benzothiazine 4,4-dioxide |
ChEMBL | CHEMBL2333445 |
DrugBank | |
ZINC | ZINC000095591813
|
PDB chain | 4ebv Chain A Residue 700
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|