Structure of PDB 4e96 Chain A Binding Site BS01 |
|
|
Ligand ID | 0NS |
InChI | InChI=1S/C16H17N3O4S/c1-19-10-11-9-12(7-8-13(11)17-16(19)20)18-24(21,22)15-6-4-3-5-14(15)23-2/h3-9,18H,10H2,1-2H3,(H,17,20) |
InChIKey | TXZPMHLMPKIUGK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CN1Cc2cc(ccc2NC1=O)NS(=O)(=O)c3ccccc3OC | ACDLabs 12.01 | O=S(=O)(c1ccccc1OC)Nc2ccc3NC(=O)N(Cc3c2)C | CACTVS 3.370 | COc1ccccc1[S](=O)(=O)Nc2ccc3NC(=O)N(C)Cc3c2 |
|
Formula | C16 H17 N3 O4 S |
Name | 2-methoxy-N-(3-methyl-2-oxo-1,2,3,4-tetrahydroquinazolin-6-yl)benzenesulfonamide |
ChEMBL | CHEMBL2179387 |
DrugBank | |
ZINC | ZINC000086003193
|
PDB chain | 4e96 Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|