Structure of PDB 4e6q Chain A Binding Site BS01 |
|
|
Ligand ID | 0NV |
InChI | InChI=1S/C20H21N5/c1-2-4-15(5-3-1)13-24-10-7-16(8-11-24)25-14-23-18-12-22-20-17(19(18)25)6-9-21-20/h1-6,9,12,14,16H,7-8,10-11,13H2,(H,21,22) |
InChIKey | WKWXJWGOAKGEEM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | C1CN(CCC1n2cnc3cnc4[nH]ccc4c23)Cc5ccccc5 | OpenEye OEToolkits 1.7.6 | c1ccc(cc1)CN2CCC(CC2)n3cnc4c3c5cc[nH]c5nc4 | ACDLabs 12.01 | n4c5c(c1c(ncn1C3CCN(Cc2ccccc2)CC3)c4)ccn5 |
|
Formula | C20 H21 N5 |
Name | 1-(1-benzylpiperidin-4-yl)-1,6-dihydroimidazo[4,5-d]pyrrolo[2,3-b]pyridine |
ChEMBL | CHEMBL2152305 |
DrugBank | |
ZINC | ZINC000095574162
|
PDB chain | 4e6q Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|