Structure of PDB 4e6d Chain A Binding Site BS01 |
|
|
Ligand ID | 0NU |
InChI | InChI=1S/C16H16N6O/c17-5-3-14(23)21-7-1-2-11(9-21)22-10-20-13-8-19-16-12(15(13)22)4-6-18-16/h4,6,8,10-11H,1-3,7,9H2,(H,18,19)/t11-/m1/s1 |
InChIKey | XTKGOBBIBUQFHY-LLVKDONJSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | O=C(CC#N)N1CCC[CH](C1)n2cnc3cnc4[nH]ccc4c23 | CACTVS 3.370 | O=C(CC#N)N1CCC[C@H](C1)n2cnc3cnc4[nH]ccc4c23 | OpenEye OEToolkits 1.7.6 | c1c[nH]c2c1c3c(cn2)ncn3[C@@H]4CCCN(C4)C(=O)CC#N | OpenEye OEToolkits 1.7.6 | c1c[nH]c2c1c3c(cn2)ncn3C4CCCN(C4)C(=O)CC#N | ACDLabs 12.01 | O=C(N4CCCC(n1c2c3ccnc3ncc2nc1)C4)CC#N |
|
Formula | C16 H16 N6 O |
Name | 3-[(3R)-3-(imidazo[4,5-d]pyrrolo[2,3-b]pyridin-1(6H)-yl)piperidin-1-yl]-3-oxopropanenitrile |
ChEMBL | CHEMBL2152300 |
DrugBank | |
ZINC | ZINC000072315838
|
PDB chain | 4e6d Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|