Structure of PDB 4e4x Chain A Binding Site BS01 |
|
|
Ligand ID | T1Q |
InChI | InChI=1S/C20H23F2N5O4S/c1-3-9-32(30,31)26-15-6-5-14(21)16(17(15)22)13-10-12-11-24-20(23-7-4-8-28)25-18(12)27(2)19(13)29/h5-6,10-11,26,28H,3-4,7-9H2,1-2H3,(H,23,24,25) |
InChIKey | HCWAUGCXCGOSNN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCC[S](=O)(=O)Nc1ccc(F)c(c1F)C2=Cc3cnc(NCCCO)nc3N(C)C2=O | OpenEye OEToolkits 1.7.6 | CCCS(=O)(=O)Nc1ccc(c(c1F)C2=Cc3cnc(nc3N(C2=O)C)NCCCO)F | ACDLabs 12.01 | O=S(=O)(Nc3ccc(F)c(C2=Cc1c(nc(nc1)NCCCO)N(C2=O)C)c3F)CCC |
|
Formula | C20 H23 F2 N5 O4 S |
Name | N-(2,4-difluoro-3-{2-[(3-hydroxypropyl)amino]-8-methyl-7-oxo-7,8-dihydropyrido[2,3-d]pyrimidin-6-yl}phenyl)propane-1-sulfonamide |
ChEMBL | CHEMBL2023498 |
DrugBank | |
ZINC | ZINC000084616404
|
PDB chain | 4e4x Chain A Residue 801
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|