Structure of PDB 4e1n Chain A Binding Site BS01 |
|
|
Ligand ID | TQX |
InChI | InChI=1S/C26H28FNO4/c1-14-16-10-8-12-31-23(16)19(27)13-18(14)22-17-9-6-7-11-20(17)28-15(2)21(22)24(25(29)30)32-26(3,4)5/h6-7,9,11,13,24H,8,10,12H2,1-5H3,(H,29,30)/t24-/m0/s1 |
InChIKey | FPVPQIOUSAJQDM-DEOSSOPVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Cc1nc2ccccc2c(c3cc(F)c4OCCCc4c3C)c1[C@H](OC(C)(C)C)C(O)=O | CACTVS 3.370 | Cc1nc2ccccc2c(c3cc(F)c4OCCCc4c3C)c1[CH](OC(C)(C)C)C(O)=O | OpenEye OEToolkits 1.7.6 | Cc1c(cc(c2c1CCCO2)F)c3c4ccccc4nc(c3C(C(=O)O)OC(C)(C)C)C | OpenEye OEToolkits 1.7.6 | Cc1c(cc(c2c1CCCO2)F)c3c4ccccc4nc(c3[C@@H](C(=O)O)OC(C)(C)C)C | ACDLabs 12.01 | O=C(O)C(OC(C)(C)C)c4c(nc1c(cccc1)c4c3cc(F)c2OCCCc2c3C)C |
|
Formula | C26 H28 F N O4 |
Name | (2S)-tert-butoxy[4-(8-fluoro-5-methyl-3,4-dihydro-2H-chromen-6-yl)-2-methylquinolin-3-yl]ethanoic acid |
ChEMBL | CHEMBL2180481 |
DrugBank | |
ZINC | ZINC000095575709
|
PDB chain | 4e1n Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|