Structure of PDB 4dvv Chain A Binding Site BS01 |
|
|
Ligand ID | 0M1 |
InChI | InChI=1S/C15H19ClFN3O4/c1-15(2)23-11(6-18)12(24-15)7-19-13(21)14(22)20-8-3-4-9(16)10(17)5-8/h3-5,11-12H,6-7,18H2,1-2H3,(H,19,21)(H,20,22)/t11-,12-/m0/s1 |
InChIKey | KUDYRECLZBUMDK-RYUDHWBXSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC1(O[C@H]([C@@H](O1)CNC(=O)C(=O)Nc2ccc(c(c2)F)Cl)CN)C | ACDLabs 12.01 | Clc1ccc(cc1F)NC(=O)C(=O)NCC2OC(OC2CN)(C)C | CACTVS 3.370 | CC1(C)O[CH](CN)[CH](CNC(=O)C(=O)Nc2ccc(Cl)c(F)c2)O1 | CACTVS 3.370 | CC1(C)O[C@@H](CN)[C@H](CNC(=O)C(=O)Nc2ccc(Cl)c(F)c2)O1 | OpenEye OEToolkits 1.7.6 | CC1(OC(C(O1)CNC(=O)C(=O)Nc2ccc(c(c2)F)Cl)CN)C |
|
Formula | C15 H19 Cl F N3 O4 |
Name | N-{[(4S,5S)-5-(aminomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl}-N'-(4-chloro-3-fluorophenyl)ethanediamide |
ChEMBL | CHEMBL1645270 |
DrugBank | |
ZINC | ZINC000066263524
|
PDB chain | 4dvv Chain A Residue 513
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|