Structure of PDB 4dea Chain A Binding Site BS01 |
|
|
Ligand ID | NHI |
InChI | InChI=1S/C18H14N4O4/c23-16(24)11-1-5-13(6-2-11)20-15-9-10-19-18(22-15)21-14-7-3-12(4-8-14)17(25)26/h1-10H,(H,23,24)(H,25,26)(H2,19,20,21,22) |
InChIKey | PZRUXYWYONKHDD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | OC(=O)c1ccc(Nc2ccnc(Nc3ccc(cc3)C(O)=O)n2)cc1 | OpenEye OEToolkits 1.7.6 | c1cc(ccc1C(=O)O)Nc2ccnc(n2)Nc3ccc(cc3)C(=O)O | ACDLabs 12.01 | O=C(O)c1ccc(cc1)Nc2nc(ncc2)Nc3ccc(C(=O)O)cc3 |
|
Formula | C18 H14 N4 O4 |
Name | 4,4'-(pyrimidine-2,4-diyldiimino)dibenzoic acid |
ChEMBL | CHEMBL2170598 |
DrugBank | |
ZINC | ZINC000004638928
|
PDB chain | 4dea Chain A Residue 504
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|