Structure of PDB 4daf Chain A Binding Site BS01 |
|
|
Ligand ID | 0J4 |
InChI | InChI=1S/C9H9N5O4/c1-2(8(17)18)4-5(15)3-6(14-13-4)11-9(10)12-7(3)16/h2H,1H3,(H,17,18)(H4,10,11,12,14,15,16)/t2-/m1/s1 |
InChIKey | GMTZUGVMBRNPHI-UWTATZPHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C[C@H](C1=NNC2=C(C1=O)C(=O)NC(=N2)N)C(=O)O | ACDLabs 12.01 | O=C(O)C(C1=NNC=2N=C(NC(=O)C=2C1=O)N)C | CACTVS 3.370 | C[CH](C(O)=O)C1=NNC2=C(C(=O)NC(=N2)N)C1=O | CACTVS 3.370 | C[C@@H](C(O)=O)C1=NNC2=C(C(=O)NC(=N2)N)C1=O | OpenEye OEToolkits 1.7.6 | CC(C1=NNC2=C(C1=O)C(=O)NC(=N2)N)C(=O)O |
|
Formula | C9 H9 N5 O4 |
Name | (2R)-2-(7-amino-4,5-dioxo-1,4,5,6-tetrahydropyrimido[4,5-c]pyridazin-3-yl)propanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920535
|
PDB chain | 4daf Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D54 K220 R254 |
Catalytic site (residue number reindexed from 1) |
D43 K198 R232 |
Enzyme Commision number |
2.5.1.15: dihydropteroate synthase. |
|
|
|