Structure of PDB 4d9p Chain A Binding Site BS01 |
|
|
Ligand ID | Z17 |
InChI | InChI=1S/C11H13N5O4/c1-4(3-5(17)18)7-8(19)6-9(16(2)15-7)13-11(12)14-10(6)20/h4H,3H2,1-2H3,(H,17,18)(H3,12,13,14,20)/t4-/m1/s1 |
InChIKey | SXWJQNIIWHUAJQ-SCSAIBSYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)CC(C1=NN(C=2N=C(NC(=O)C=2C1=O)N)C)C | CACTVS 3.370 | C[CH](CC(O)=O)C1=NN(C)C2=C(C(=O)NC(=N2)N)C1=O | OpenEye OEToolkits 1.7.6 | CC(CC(=O)O)C1=NN(C2=C(C1=O)C(=O)NC(=N2)N)C | OpenEye OEToolkits 1.7.6 | C[C@H](CC(=O)O)C1=NN(C2=C(C1=O)C(=O)NC(=N2)N)C | CACTVS 3.370 | C[C@H](CC(O)=O)C1=NN(C)C2=C(C(=O)NC(=N2)N)C1=O |
|
Formula | C11 H13 N5 O4 |
Name | (3R)-3-(7-amino-1-methyl-4,5-dioxo-1,4,5,6-tetrahydropyrimido[4,5-c]pyridazin-3-yl)butanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920570
|
PDB chain | 4d9p Chain A Residue 306
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|