Structure of PDB 4cxx Chain A Binding Site BS01 |
|
|
Ligand ID | 640 |
InChI | InChI=1S/C21H23N3O4/c1-21(2,3)16-6-4-14(5-7-16)12-15-10-11-22-13-17(15)20(28)24-23-18(25)8-9-19(26)27/h4-11,13H,12H2,1-3H3,(H,23,25)(H,24,28)(H,26,27)/b9-8+ |
InChIKey | BNGBOJVHKLUMFE-CMDGGOBGSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(C)(C)c1ccc(cc1)Cc2ccncc2C(=O)NNC(=O)/C=C/C(=O)O | ACDLabs 12.01 | O=C(c1c(ccnc1)Cc2ccc(cc2)C(C)(C)C)NNC(=O)\C=C\C(=O)O | CACTVS 3.385 | CC(C)(C)c1ccc(Cc2ccncc2C(=O)NNC(=O)C=CC(O)=O)cc1 | CACTVS 3.385 | CC(C)(C)c1ccc(Cc2ccncc2C(=O)NNC(=O)/C=C/C(O)=O)cc1 | OpenEye OEToolkits 1.7.6 | CC(C)(C)c1ccc(cc1)Cc2ccncc2C(=O)NNC(=O)C=CC(=O)O |
|
Formula | C21 H23 N3 O4 |
Name | (2E)-4-{N'-[4-(4-tert-Butyl-benzyl)-pyridine-3-carbonyl]-hydrazino}-4-oxo-but-2-enoic acid |
ChEMBL | CHEMBL5289143 |
DrugBank | |
ZINC | ZINC000263620280
|
PDB chain | 4cxx Chain A Residue 1505
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|