Structure of PDB 4cwt Chain A Binding Site BS01 |
|
|
Ligand ID | IK9 |
InChI | InChI=1S/C19H17FN6O3/c20-11-7-12(22-3-4-27)17-13(8-11)23-16(26-18(17)24-19(21)25-26)6-10-1-2-14-15(5-10)29-9-28-14/h1-2,5,7-8,22,27H,3-4,6,9H2,(H2,21,25) |
InChIKey | VTYBTDCJZWSDTA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OCCNc1cc(F)cc2N=C(Cc3ccc4OCOc4c3)N5NC(=N)N=C5c12 | OpenEye OEToolkits 1.7.6 | c1cc2c(cc1CC3=Nc4cc(cc(c4C5=NC(=N)NN35)NCCO)F)OCO2 | ACDLabs 12.01 | Fc3cc2N=C(N1C(=NC(=[N@H])N1)c2c(NCCO)c3)Cc4ccc5OCOc5c4 |
|
Formula | C19 H17 F N6 O3 |
Name | 2-{[(2Z)-5-(1,3-benzodioxol-5-ylmethyl)-8-fluoro-2-imino-2,3-dihydro[1,2,4]triazolo[1,5-c]quinazolin-10-yl]amino}ethanol |
ChEMBL | CHEMBL3310152 |
DrugBank | |
ZINC | ZINC000098209023
|
PDB chain | 4cwt Chain A Residue 1225
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.6.4.10: non-chaperonin molecular chaperone ATPase. |
|
|
|