Structure of PDB 4cwf Chain A Binding Site BS01 |
|
|
Ligand ID | H05 |
InChI | InChI=1S/C12H13N5/c1-2-5-10-14-9-7-4-3-6-8(9)11-15-12(13)16-17(10)11/h3-4,6-7H,2,5H2,1H3,(H2,13,16) |
InChIKey | WFRPCMTYTZUBRF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CCCc1nc2ccccc2c3n1nc(n3)N | CACTVS 3.385 | CCCc1nc2ccccc2c3nc(N)nn13 | ACDLabs 12.01 | n1c(n3nc(nc3c2c1cccc2)N)CCC |
|
Formula | C12 H13 N5 |
Name | 5-propyl[1,2,4]triazolo[1,5-c]quinazolin-2-amine |
ChEMBL | CHEMBL1603585 |
DrugBank | |
ZINC | ZINC000000469823
|
PDB chain | 4cwf Chain A Residue 1224
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.6.4.10: non-chaperonin molecular chaperone ATPase. |
|
|
|