Structure of PDB 4cw3 Chain A Binding Site BS01 |
|
|
Ligand ID | XDS |
InChI | InChI=1S/C6H6N4O5/c1-10-2-6(15-14,9-5(10)13)3(11)8-4(12)7-2/h14H,1H3,(H,9,13)(H,8,11,12)/t6-/m0/s1 |
InChIKey | JQXTWGOGXIASQD-LURJTMIESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CN1C(=O)N[C@@]2(OO)C(=O)NC(=O)N=C12 | OpenEye OEToolkits 1.7.6 | CN1C2=NC(=O)NC(=O)C2(NC1=O)OO | CACTVS 3.385 | CN1C(=O)N[C]2(OO)C(=O)NC(=O)N=C12 | OpenEye OEToolkits 1.7.6 | CN1C2=NC(=O)NC(=O)[C@@]2(NC1=O)OO | ACDLabs 12.01 | O=C2N=C1N(C(=O)NC1(OO)C(=O)N2)C |
|
Formula | C6 H6 N4 O5 |
Name | (5S)-5-(dioxidanyl)-9-methyl-7H-purine-2,6,8-trione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000223254619
|
PDB chain | 4cw3 Chain A Residue 1302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|