Structure of PDB 4ctc Chain A Binding Site BS01 |
|
|
Ligand ID | J99 |
InChI | InChI=1S/C23H24FN5O2/c1-12-17-9-15(24)6-7-16(17)23(30)28(2)11-18-20(21(13-4-5-13)27-29(18)3)14-8-19(31-12)22(25)26-10-14/h6-10,12-13H,4-5,11H2,1-3H3,(H2,25,26)/t12-/m1/s1 |
InChIKey | SBEYSILWLYDNSN-GFCCVEGCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC1c2cc(ccc2C(=O)N(Cc3c(c(nn3C)C4CC4)-c5cc(c(nc5)N)O1)C)F | OpenEye OEToolkits 1.7.6 | C[C@@H]1c2cc(ccc2C(=O)N(Cc3c(c(nn3C)C4CC4)-c5cc(c(nc5)N)O1)C)F | ACDLabs 12.01 | Fc3ccc2C(=O)N(Cc1n(nc(c1c4cc(OC(c2c3)C)c(nc4)N)C5CC5)C)C | CACTVS 3.385 | C[C@H]1Oc2cc(cnc2N)c3c(CN(C)C(=O)c4ccc(F)cc14)n(C)nc3C5CC5 | CACTVS 3.385 | C[CH]1Oc2cc(cnc2N)c3c(CN(C)C(=O)c4ccc(F)cc14)n(C)nc3C5CC5 |
|
Formula | C23 H24 F N5 O2 |
Name | (10R)-7-amino-3-cyclopropyl-12-fluoro-1,10,16-trimethyl-16,17-dihydro-1H-8,4-(metheno)pyrazolo[4,3-h][2,5,11]benzoxadiazacyclotetradecin-15(10H)-one |
ChEMBL | CHEMBL3286829 |
DrugBank | |
ZINC | ZINC000098209037
|
PDB chain | 4ctc Chain A Residue 2402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
Global view | Local view | Structure summary |
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
[Spin on]
[Spin off]
[Reset]
[High quality]
[Low quality]
[White background]
[Black background]
|
PDB | 4ctc Discovery of (10R)-7-Amino-12-Fluoro-2,10,16-Trimethyl-15-Oxo-10,15,16,17-Tetrahydro-2H-8,4-(Metheno)Pyrazolo[4,3-H][2,5,11]Benzoxadiazacyclotetradecine-3-Carbonitrile (Pf-06463922), a Macrocyclic Inhibitor of Alk/Ros1 with Pre-Clinical Brain Exposure and Broad Spectrum Potency Against Alk-Resistant Mutations. |
Resolution | 2.03 Å |
Binding residue (original residue number in PDB) | L1122 V1130 A1148 E1197 M1199 A1200 N1254 L1256 G1269 D1270 Y1401 |
Binding residue (residue number reindexed from 1) | L29 V33 A43 E92 M94 A95 N149 L151 G164 D165 Y288 |
Annotation score | 1 |
Binding affinity | BindingDB: IC50=5.8nM,Ki=<0.100000nM |
|
|
|
|
|