Structure of PDB 4clz Chain A Binding Site BS01 |
|
|
Ligand ID | 4DS |
InChI | InChI=1S/C16H10N2O6S4/c19-27(20,21)15-7-13(17-9-25)5-3-11(15)1-2-12-4-6-14(18-10-26)8-16(12)28(22,23)24/h1-8H,(H,19,20,21)(H,22,23,24)/b2-1+ |
InChIKey | YSCNMFDFYJUPEF-OWOJBTEDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(c(cc1N=C=S)S(=O)(=O)O)/C=C/c2ccc(cc2S(=O)(=O)O)N=C=S | CACTVS 3.385 | O[S](=O)(=O)c1cc(ccc1C=Cc2ccc(cc2[S](O)(=O)=O)N=C=S)N=C=S | ACDLabs 12.01 | O=S(=O)(O)c1cc(\N=C=S)ccc1\C=C\c2ccc(\N=C=S)cc2S(=O)(=O)O | OpenEye OEToolkits 1.7.6 | c1cc(c(cc1N=C=S)S(=O)(=O)O)C=Cc2ccc(cc2S(=O)(=O)O)N=C=S | CACTVS 3.385 | O[S](=O)(=O)c1cc(ccc1/C=C/c2ccc(cc2[S](O)(=O)=O)N=C=S)N=C=S |
|
Formula | C16 H10 N2 O6 S4 |
Name | 4,4'-Diisothiocyano-2,2'-stilbenedisulfonic acid |
ChEMBL | CHEMBL1162148 |
DrugBank | |
ZINC | ZINC000006844860
|
PDB chain | 4clz Chain A Residue 1479
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
4.6.1.1: adenylate cyclase. |
|
|
|